C12H17NO8 — CID 25147274
(1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid (PubChem CID 25147274) has the molecular formula C12H17NO8 and a molecular weight of 303.27 g/mol. Its IUPAC name is (1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid |
|---|---|
| PubChem CID | 25147274 |
| Molecular Formula | C12H17NO8 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid |
| SMILES | O=C(O)C[C@]12O[C@@H]3[C@@H](O)[C@@H](O)CO[C@@H]3[C@H]1CN[C@@H]2C(=O)O |
| InChI | InChI=1S/C12H17NO8/c14-5-3-20-8-4-2-13-10(11(18)19)12(4,1-6(15)16)21-9(8)7(5)17/h4-5,7-10,13-14,17H,1-3H2,(H,15,16)(H,18,19)/t4-,5+,7+,8-,9-,10-,12+/m1/s1 |
| InChIKey | CJFLTILDUCULHG-NMTMTVDKSA-N |
| XLogP | -2.61 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |