C13H19NO8 — CID 25147275
(1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,13-dioxa-4-azatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid (PubChem CID 25147275) has the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. Its IUPAC name is (1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,13-dioxa-4-azatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,13-dioxa-4-azatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid |
|---|---|
| PubChem CID | 25147275 |
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (1R,2R,5S,6S,8R,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7,13-dioxa-4-azatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid |
| SMILES | O=C(O)C[C@]12O[C@@H]3[C@@H](O)[C@@H](O)CCO[C@@H]3[C@H]1CN[C@@H]2C(=O)O |
| InChI | InChI=1S/C13H19NO8/c15-6-1-2-21-9-5-4-14-11(12(19)20)13(5,3-7(16)17)22-10(9)8(6)18/h5-6,8-11,14-15,18H,1-4H2,(H,16,17)(H,19,20)/t5-,6+,8+,9-,10-,11-,13+/m1/s1 |
| InChIKey | NGXUKXZESBWPFX-FRHKKKCUSA-N |
| XLogP | -2.22 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |