C12H18N2O7 — CID 25147276
(1R,2R,5S,6S,8S,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid (PubChem CID 25147276) has the molecular formula C12H18N2O7 and a molecular weight of 302.28 g/mol. Its IUPAC name is (1R,2R,5S,6S,8S,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,8S,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid |
|---|---|
| PubChem CID | 25147276 |
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (1R,2R,5S,6S,8S,9S,10S)-6-(carboxymethyl)-9,10-dihydroxy-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid |
| SMILES | O=C(O)C[C@]12O[C@@H]3[C@@H](O)[C@@H](O)CN[C@@H]3[C@H]1CN[C@@H]2C(=O)O |
| InChI | InChI=1S/C12H18N2O7/c15-5-3-13-7-4-2-14-10(11(19)20)12(4,1-6(16)17)21-9(7)8(5)18/h4-5,7-10,13-15,18H,1-3H2,(H,16,17)(H,19,20)/t4-,5+,7-,8+,9+,10-,12+/m1/s1 |
| InChIKey | KWKFJWMQEHEXLX-DGSHNOEFSA-N |
| XLogP | -3.04 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |