C12H17NO6 — CID 25147386
(1R,2R,5S,6S,8R)-6-(carboxymethyl)-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid (PubChem CID 25147386) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is (1R,2R,5S,6S,8R)-6-(carboxymethyl)-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,8R)-6-(carboxymethyl)-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid |
|---|---|
| PubChem CID | 25147386 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (1R,2R,5S,6S,8R)-6-(carboxymethyl)-7,12-dioxa-4-azatricyclo[6.4.0.02,6]dodecane-5-carboxylic acid |
| SMILES | O=C(O)C[C@]12O[C@@H]3CCCO[C@@H]3[C@H]1CN[C@@H]2C(=O)O |
| InChI | InChI=1S/C12H17NO6/c14-8(15)4-12-6(5-13-10(12)11(16)17)9-7(19-12)2-1-3-18-9/h6-7,9-10,13H,1-5H2,(H,14,15)(H,16,17)/t6-,7-,9-,10-,12+/m1/s1 |
| InChIKey | SSYNCMIVXXXJPQ-IKKWRGQYSA-N |
| XLogP | -0.55 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |