C15H16O3 — CID 25147592
(5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5H-1-benzofuran-4,7-dione (PubChem CID 25147592) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5H-1-benzofuran-4,7-dione.
| Compound Name | (5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5H-1-benzofuran-4,7-dione |
|---|---|
| PubChem CID | 25147592 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5H-1-benzofuran-4,7-dione |
| SMILES | C=C[C@]1(C)C(=O)c2occ(C)c2C(=O)[C@H]1C(=C)C |
| InChI | InChI=1S/C15H16O3/c1-6-15(5)11(8(2)3)12(16)10-9(4)7-18-13(10)14(15)17/h6-7,11H,1-2H2,3-5H3/t11-,15+/m1/s1 |
| InChIKey | RLWUPZZWFFGPKU-ABAIWWIYSA-N |
| XLogP | 3.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|