C18H14N2O — CID 25147692
6-isoquinolin-4-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 25147692) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 6-isoquinolin-4-yl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-isoquinolin-4-yl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 25147692 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 6-isoquinolin-4-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(-c3cncc4ccccc34)ccc2N1 |
| InChI | InChI=1S/C18H14N2O/c21-18-8-6-13-9-12(5-7-17(13)20-18)16-11-19-10-14-3-1-2-4-15(14)16/h1-5,7,9-11H,6,8H2,(H,20,21) |
| InChIKey | TVVPAZUMRVMIFM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |