About 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one
4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one (PubChem CID 25147786) has the molecular formula C9H13N3O2Se
and a molecular weight of 274.18 g/mol. Its IUPAC name is 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
| PubChem CID | 25147786 |
| Molecular Formula | C9H13N3O2Se |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@H]2CC[C@@H](CO)[Se]2)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O2Se/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14)/t6-,8+/m0/s1 |
| InChIKey | MGDLOMKNFCDRTA-POYBYMJQSA-N |
| XLogP | -0.40 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one (CID 25147786) is 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one is Nc1ccn([C@H]2CC[C@@H](CO)[Se]2)c(=O)n1.
What is the InChIKey of 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one?
The InChIKey is MGDLOMKNFCDRTA-POYBYMJQSA-N. The full InChI is InChI=1S/C9H13N3O2Se/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14)/t6-,8+/m0/s1.
What are the key properties of 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one?
4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one has a molecular weight of 274.18 g/mol, XLogP of -0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(2R,5S)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one is sourced from PubChem (CID 25147786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).