About 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide
2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2514833) has the molecular formula C13H14N2O2S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 2514833 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCOc1ccc(CC(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C13H14N2O2S/c1-2-17-11-5-3-10(4-6-11)9-12(16)15-13-14-7-8-18-13/h3-8H,2,9H2,1H3,(H,14,15,16) |
| InChIKey | ZHCMQUXVGLVNPJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide (CID 2514833) is 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide is CCOc1ccc(CC(=O)Nc2nccs2)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is ZHCMQUXVGLVNPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S/c1-2-17-11-5-3-10(4-6-11)9-12(16)15-13-14-7-8-18-13/h3-8H,2,9H2,1H3,(H,14,15,16).
What are the key properties of 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide?
2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 262.33 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 2514833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).