C16H11F3N4 — CID 25148571
3-benzyl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine (PubChem CID 25148571) has the molecular formula C16H11F3N4 and a molecular weight of 316.29 g/mol. Its IUPAC name is 3-benzyl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine.
| Compound Name | 3-benzyl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 25148571 |
| Molecular Formula | C16H11F3N4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-benzyl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine |
| SMILES | FC(F)(F)c1ccc(-c2nnc(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C16H11F3N4/c17-16(18,19)13-8-6-12(7-9-13)15-22-20-14(21-23-15)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | MICZRAVMKNPSEM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |