About 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea
1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea (PubChem CID 25148594) has the molecular formula C13H14F3N5O
and a molecular weight of 313.28 g/mol. Its IUPAC name is 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea |
| PubChem CID | 25148594 |
| Molecular Formula | C13H14F3N5O |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1c(N)c(C(F)(F)F)nn1-c1ccccc1 |
| InChI | InChI=1S/C13H14F3N5O/c1-18-12(22)20(2)11-9(17)10(13(14,15)16)19-21(11)8-6-4-3-5-7-8/h3-7H,17H2,1-2H3,(H,18,22) |
| InChIKey | DHBBRGJMRVKQFU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea?
The IUPAC name of 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea (CID 25148594) is 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea.
What is the SMILES notation for 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea?
The canonical SMILES for 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea is CNC(=O)N(C)c1c(N)c(C(F)(F)F)nn1-c1ccccc1.
What is the InChIKey of 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea?
The InChIKey is DHBBRGJMRVKQFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N5O/c1-18-12(22)20(2)11-9(17)10(13(14,15)16)19-21(11)8-6-4-3-5-7-8/h3-7H,17H2,1-2H3,(H,18,22).
What are the key properties of 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea?
1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea has a molecular weight of 313.28 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-amino-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-1,3-dimethylurea is sourced from PubChem (CID 25148594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).