C29H22N2O2P+ — CID 25148971
(1',3'-dioxospiro[1,4-dihydropyrazole-5,2'-indene]-3-yl)-triphenylphosphanium (PubChem CID 25148971) has the molecular formula C29H22N2O2P+ and a molecular weight of 461.48 g/mol. Its IUPAC name is (1',3'-dioxospiro[1,4-dihydropyrazole-5,2'-indene]-3-yl)-triphenylphosphanium.
| Compound Name | (1',3'-dioxospiro[1,4-dihydropyrazole-5,2'-indene]-3-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 25148971 |
| Molecular Formula | C29H22N2O2P+ |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (1',3'-dioxospiro[1,4-dihydropyrazole-5,2'-indene]-3-yl)-triphenylphosphanium |
| SMILES | O=C1c2ccccc2C(=O)C12CC([P+](c1ccccc1)(c1ccccc1)c1ccccc1)=NN2 |
| InChI | InChI=1S/C29H22N2O2P/c32-27-24-18-10-11-19-25(24)28(33)29(27)20-26(30-31-29)34(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-19,31H,20H2/q+1 |
| InChIKey | ZNGBXIRKXPYKRW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|