About 9-phenylimidazo[1,2-h][1,7]naphthyridine
9-phenylimidazo[1,2-h][1,7]naphthyridine (PubChem CID 25149042) has the molecular formula C16H11N3
and a molecular weight of 245.29 g/mol. Its IUPAC name is 9-phenylimidazo[1,2-h][1,7]naphthyridine.
Molecular Properties
| Compound Name | 9-phenylimidazo[1,2-h][1,7]naphthyridine |
| PubChem CID | 25149042 |
| Molecular Formula | C16H11N3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 9-phenylimidazo[1,2-h][1,7]naphthyridine |
| SMILES | c1ccc(-c2ccc3ccn4ccnc4c3n2)cc1 |
| InChI | InChI=1S/C16H11N3/c1-2-4-12(5-3-1)14-7-6-13-8-10-19-11-9-17-16(19)15(13)18-14/h1-11H |
| InChIKey | GEPXWAHOOCLVOY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-phenylimidazo[1,2-h][1,7]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenylimidazo[1,2-h][1,7]naphthyridine?
The IUPAC name of 9-phenylimidazo[1,2-h][1,7]naphthyridine (CID 25149042) is 9-phenylimidazo[1,2-h][1,7]naphthyridine.
What is the SMILES notation for 9-phenylimidazo[1,2-h][1,7]naphthyridine?
The canonical SMILES for 9-phenylimidazo[1,2-h][1,7]naphthyridine is c1ccc(-c2ccc3ccn4ccnc4c3n2)cc1.
What is the InChIKey of 9-phenylimidazo[1,2-h][1,7]naphthyridine?
The InChIKey is GEPXWAHOOCLVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3/c1-2-4-12(5-3-1)14-7-6-13-8-10-19-11-9-17-16(19)15(13)18-14/h1-11H.
What are the key properties of 9-phenylimidazo[1,2-h][1,7]naphthyridine?
9-phenylimidazo[1,2-h][1,7]naphthyridine has a molecular weight of 245.29 g/mol, XLogP of 3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenylimidazo[1,2-h][1,7]naphthyridine is sourced from PubChem (CID 25149042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).