About 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one
10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one (PubChem CID 25149070) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one.
Molecular Properties
| Compound Name | 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one |
| PubChem CID | 25149070 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one |
| SMILES | CCCCC12c3ccccc3C=CN1C(=O)NC2(C)C |
| InChI | InChI=1S/C17H22N2O/c1-4-5-11-17-14-9-7-6-8-13(14)10-12-19(17)15(20)18-16(17,2)3/h6-10,12H,4-5,11H2,1-3H3,(H,18,20) |
| InChIKey | MWDPPLDMTJTMHL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one?
The IUPAC name of 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one (CID 25149070) is 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one.
What is the SMILES notation for 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one?
The canonical SMILES for 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one is CCCCC12c3ccccc3C=CN1C(=O)NC2(C)C.
What is the InChIKey of 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one?
The InChIKey is MWDPPLDMTJTMHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-4-5-11-17-14-9-7-6-8-13(14)10-12-19(17)15(20)18-16(17,2)3/h6-10,12H,4-5,11H2,1-3H3,(H,18,20).
What are the key properties of 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one?
10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one has a molecular weight of 270.38 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10b-butyl-1,1-dimethyl-2H-imidazo[5,1-a]isoquinolin-3-one is sourced from PubChem (CID 25149070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).