About (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one
(5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 25149224) has the molecular formula C21H22N2O2S
and a molecular weight of 366.49 g/mol. Its IUPAC name is (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one |
| PubChem CID | 25149224 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C/C(C)(C)C)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-21(2,3)14-18-19(24)23(16-10-12-17(25-4)13-11-16)20(26-18)22-15-8-6-5-7-9-15/h5-14H,1-4H3/b18-14-,22-20- |
| InChIKey | FRSBMRXCRNIHAG-JHRGVAJVSA-N |
| XLogP | 5.39 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one?
The IUPAC name of (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one (CID 25149224) is (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one.
What is the SMILES notation for (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one?
The canonical SMILES for (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one is COc1ccc(N2C(=O)/C(=C/C(C)(C)C)S/C2=N\c2ccccc2)cc1.
What is the InChIKey of (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one?
The InChIKey is FRSBMRXCRNIHAG-JHRGVAJVSA-N. The full InChI is InChI=1S/C21H22N2O2S/c1-21(2,3)14-18-19(24)23(16-10-12-17(25-4)13-11-16)20(26-18)22-15-8-6-5-7-9-15/h5-14H,1-4H3/b18-14-,22-20-.
What are the key properties of (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one?
(5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one has a molecular weight of 366.49 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-(2,2-dimethylpropylidene)-3-(4-methoxyphenyl)-2-phenylimino-1,3-thiazolidin-4-one is sourced from PubChem (CID 25149224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).