C48H58N4O6 — CID 25149264
2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-5-[2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione (PubChem CID 25149264) has the molecular formula C48H58N4O6 and a molecular weight of 787.01 g/mol. Its IUPAC name is 2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-5-[2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-5-[2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 25149264 |
| Molecular Formula | C48H58N4O6 |
| Molecular Weight | 787.01 g/mol |
| Exact Mass | 786.44 |
| IUPAC Name | 2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-5-[2-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
| SMILES | CCN(CCCCCCN1C(=O)c2ccc(-c3ccc4c(c3)C(=O)N(CCCCCCN(CC)Cc3ccccc3OC)C4=O)cc2C1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C48H58N4O6/c1-5-49(33-37-19-11-13-21-43(37)57-3)27-15-7-9-17-29-51-45(53)39-25-23-35(31-41(39)47(51)55)36-24-26-40-42(32-36)48(56)52(46(40)54)30-18-10-8-16-28-50(6-2)34-38-20-12-14-22-44(38)58-4/h11-14,19-26,31-32H,5-10,15-18,27-30,33-34H2,1-4H3 |
| InChIKey | BLQXTZGJGNTPNF-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.01 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|