About N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide
N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide (PubChem CID 25149384) has the molecular formula C20H18N4O2S
and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide |
| PubChem CID | 25149384 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide |
| SMILES | [N-]=[N+]=N[C@H](c1ccccc1)[C@@H](NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18N4O2S/c21-24-22-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)23-27(25,26)18-14-8-3-9-15-18/h1-15,19-20,23H/t19-,20+/m1/s1 |
| InChIKey | XVFMECAAJNQPLO-UXHICEINSA-N |
| XLogP | 4.76 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide?
The IUPAC name of N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide (CID 25149384) is N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide.
What is the SMILES notation for N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide?
The canonical SMILES for N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide is [N-]=[N+]=N[C@H](c1ccccc1)[C@@H](NS(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide?
The InChIKey is XVFMECAAJNQPLO-UXHICEINSA-N. The full InChI is InChI=1S/C20H18N4O2S/c21-24-22-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)23-27(25,26)18-14-8-3-9-15-18/h1-15,19-20,23H/t19-,20+/m1/s1.
What are the key properties of N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide?
N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide has a molecular weight of 378.46 g/mol, XLogP of 4.76, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2R)-2-azido-1,2-diphenylethyl]benzenesulfonamide is sourced from PubChem (CID 25149384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).