C28H32N8OSi — CID 25150283
9-[(1S,3S,4S,5S)-3-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[3.1.0]hexanyl]purin-6-amine (PubChem CID 25150283) has the molecular formula C28H32N8OSi and a molecular weight of 524.71 g/mol. Its IUPAC name is 9-[(1S,3S,4S,5S)-3-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[3.1.0]hexanyl]purin-6-amine.
| Compound Name | 9-[(1S,3S,4S,5S)-3-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[3.1.0]hexanyl]purin-6-amine |
|---|---|
| PubChem CID | 25150283 |
| Molecular Formula | C28H32N8OSi |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 9-[(1S,3S,4S,5S)-3-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[3.1.0]hexanyl]purin-6-amine |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@@H](N=[N+]=[N-])C[C@@]2(n3cnc4c(N)ncnc43)C[C@@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N8OSi/c1-27(2,3)38(19-10-6-4-7-11-19,20-12-8-5-9-13-20)37-16-21-22-14-28(22,15-23(21)34-35-30)36-18-33-24-25(29)31-17-32-26(24)36/h4-13,17-18,21-23H,14-16H2,1-3H3,(H2,29,31,32)/t21-,22-,23-,28-/m0/s1 |
| InChIKey | SOQIVGGJFAWXAE-AMZZYFJHSA-N |
| XLogP | 4.40 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|