C42H54N4O6 — CID 25150453
2,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 25150453) has the molecular formula C42H54N4O6 and a molecular weight of 710.92 g/mol. Its IUPAC name is 2,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 25150453 |
| Molecular Formula | C42H54N4O6 |
| Molecular Weight | 710.92 g/mol |
| Exact Mass | 710.40 |
| IUPAC Name | 2,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCN(CCCCCCn1c(=O)c2cc3c(=O)n(CCCCCCN(CC)Cc4ccccc4OC)c(=O)c3cc2c1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C42H54N4O6/c1-5-43(29-31-19-11-13-21-37(31)51-3)23-15-7-9-17-25-45-39(47)33-27-35-36(28-34(33)40(45)48)42(50)46(41(35)49)26-18-10-8-16-24-44(6-2)30-32-20-12-14-22-38(32)52-4/h11-14,19-22,27-28H,5-10,15-18,23-26,29-30H2,1-4H3 |
| InChIKey | ZVPMATGRPXLGBJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 103.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.92 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|