C15H16N2OS — CID 25150628
cis-(1R,2R)-2-(aminomethyl)-N,N-bis(prop-2-ynyl)-1-thiophen-2-ylcyclopropane-1-carboxamide (PubChem CID 25150628) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is cis-(1R,2R)-2-(aminomethyl)-N,N-bis(prop-2-ynyl)-1-thiophen-2-ylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-2-(aminomethyl)-N,N-bis(prop-2-ynyl)-1-thiophen-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 25150628 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | cis-(1R,2R)-2-(aminomethyl)-N,N-bis(prop-2-ynyl)-1-thiophen-2-ylcyclopropane-1-carboxamide |
| SMILES | C#CCN(CC#C)C(=O)[C@@]1(c2cccs2)C[C@H]1CN |
| InChI | InChI=1S/C15H16N2OS/c1-3-7-17(8-4-2)14(18)15(10-12(15)11-16)13-6-5-9-19-13/h1-2,5-6,9,12H,7-8,10-11,16H2/t12-,15-/m0/s1 |
| InChIKey | DDNDQTODRFYZEU-WFASDCNBSA-N |
| XLogP | 1.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|