C12H17N — CID 25150644
(2S,3R)-1,2,3-trimethyl-2-(2-methylphenyl)aziridine (PubChem CID 25150644) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (2S,3R)-1,2,3-trimethyl-2-(2-methylphenyl)aziridine.
| Compound Name | (2S,3R)-1,2,3-trimethyl-2-(2-methylphenyl)aziridine |
|---|---|
| PubChem CID | 25150644 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2S,3R)-1,2,3-trimethyl-2-(2-methylphenyl)aziridine |
| SMILES | Cc1ccccc1[C@@]1(C)[C@@H](C)N1C |
| InChI | InChI=1S/C12H17N/c1-9-7-5-6-8-11(9)12(3)10(2)13(12)4/h5-8,10H,1-4H3/t10-,12-,13?/m1/s1 |
| InChIKey | WORBFIXQSZZCHH-HLVWMGJTSA-N |
| XLogP | 2.54 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|