About [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate
[4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate (PubChem CID 25150689) has the molecular formula C21H25F3O5S
and a molecular weight of 446.49 g/mol. Its IUPAC name is [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
| PubChem CID | 25150689 |
| Molecular Formula | C21H25F3O5S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
| SMILES | COCOc1ccc(Cc2c(C)cc(OS(=O)(=O)C(F)(F)F)cc2C)cc1C(C)C |
| InChI | InChI=1S/C21H25F3O5S/c1-13(2)18-10-16(6-7-20(18)28-12-27-5)11-19-14(3)8-17(9-15(19)4)29-30(25,26)21(22,23)24/h6-10,13H,11-12H2,1-5H3 |
| InChIKey | SUZHATSZZZCOEP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate?
The IUPAC name of [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate (CID 25150689) is [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate is COCOc1ccc(Cc2c(C)cc(OS(=O)(=O)C(F)(F)F)cc2C)cc1C(C)C.
What is the InChIKey of [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate?
The InChIKey is SUZHATSZZZCOEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F3O5S/c1-13(2)18-10-16(6-7-20(18)28-12-27-5)11-19-14(3)8-17(9-15(19)4)29-30(25,26)21(22,23)24/h6-10,13H,11-12H2,1-5H3.
What are the key properties of [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate?
[4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate has a molecular weight of 446.49 g/mol, XLogP of 5.23, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate is sourced from PubChem (CID 25150689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).