About disodium;butane
disodium;butane (PubChem CID 25150770) has the molecular formula C4H8Na2
and a molecular weight of 102.09 g/mol. Its IUPAC name is disodium;butane.
Molecular Properties
| Compound Name | disodium;butane |
| PubChem CID | 25150770 |
| Molecular Formula | C4H8Na2 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | disodium;butane |
| SMILES | [CH2-]CC[CH2-].[Na+].[Na+] |
| InChI | InChI=1S/C4H8.2Na/c1-3-4-2;;/h1-4H2;;/q-2;2*+1 |
| InChIKey | CMZVSRZGTGTMIM-UHFFFAOYSA-N |
| XLogP | -4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze disodium;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;butane?
The IUPAC name of disodium;butane (CID 25150770) is disodium;butane.
What is the SMILES notation for disodium;butane?
The canonical SMILES for disodium;butane is [CH2-]CC[CH2-].[Na+].[Na+].
What is the InChIKey of disodium;butane?
The InChIKey is CMZVSRZGTGTMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.2Na/c1-3-4-2;;/h1-4H2;;/q-2;2*+1.
What are the key properties of disodium;butane?
disodium;butane has a molecular weight of 102.09 g/mol, XLogP of -4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;butane is sourced from PubChem (CID 25150770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).