About methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate
methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate (PubChem CID 25150855) has the molecular formula C17H14F2INO4
and a molecular weight of 461.20 g/mol. Its IUPAC name is methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate |
| PubChem CID | 25150855 |
| Molecular Formula | C17H14F2INO4 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1cc(-c2ccc(F)cc2F)cc(I)c1O |
| InChI | InChI=1S/C17H14F2INO4/c1-25-15(22)4-5-21-17(24)12-6-9(7-14(20)16(12)23)11-3-2-10(18)8-13(11)19/h2-3,6-8,23H,4-5H2,1H3,(H,21,24) |
| InChIKey | ZMRRBWRMQPQQAN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate?
The IUPAC name of methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate (CID 25150855) is methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate.
What is the SMILES notation for methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate?
The canonical SMILES for methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate is COC(=O)CCNC(=O)c1cc(-c2ccc(F)cc2F)cc(I)c1O.
What is the InChIKey of methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate?
The InChIKey is ZMRRBWRMQPQQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2INO4/c1-25-15(22)4-5-21-17(24)12-6-9(7-14(20)16(12)23)11-3-2-10(18)8-13(11)19/h2-3,6-8,23H,4-5H2,1H3,(H,21,24).
What are the key properties of methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate?
methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate has a molecular weight of 461.20 g/mol, XLogP of 3.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]propanoate is sourced from PubChem (CID 25150855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).