C26H22N6O3S — CID 25151034
N-(2-aminophenyl)-4-[[4-[6-(oxetan-3-yloxy)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 25151034) has the molecular formula C26H22N6O3S and a molecular weight of 498.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-[6-(oxetan-3-yloxy)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-[6-(oxetan-3-yloxy)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 25151034 |
| Molecular Formula | C26H22N6O3S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-[6-(oxetan-3-yloxy)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(Nc2nc(-c3cnc4ccc(OC5COC5)cn34)cs2)cc1 |
| InChI | InChI=1S/C26H22N6O3S/c27-20-3-1-2-4-21(20)30-25(33)16-5-7-17(8-6-16)29-26-31-22(15-36-26)23-11-28-24-10-9-18(12-32(23)24)35-19-13-34-14-19/h1-12,15,19H,13-14,27H2,(H,29,31)(H,30,33) |
| InChIKey | ASTMUPJNSIQPDR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|