C27H24N6O2S — CID 25151223
N-(2-aminophenyl)-4-[[4-(6-cyclobutyloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 25151223) has the molecular formula C27H24N6O2S and a molecular weight of 496.60 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-(6-cyclobutyloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-(6-cyclobutyloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 25151223 |
| Molecular Formula | C27H24N6O2S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-(6-cyclobutyloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(Nc2nc(-c3cnc4ccc(OC5CCC5)cn34)cs2)cc1 |
| InChI | InChI=1S/C27H24N6O2S/c28-21-6-1-2-7-22(21)31-26(34)17-8-10-18(11-9-17)30-27-32-23(16-36-27)24-14-29-25-13-12-20(15-33(24)25)35-19-4-3-5-19/h1-2,6-16,19H,3-5,28H2,(H,30,32)(H,31,34) |
| InChIKey | HIBOTQJBQZSKAR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|