About 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea
1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea (PubChem CID 25151701) has the molecular formula C16H16N6S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea.
Molecular Properties
| Compound Name | 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea |
| PubChem CID | 25151701 |
| Molecular Formula | C16H16N6S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1ccc2ncc(Nc3ccccc3)nc2n1 |
| InChI | InChI=1S/C16H16N6S/c1-2-17-16(23)22-13-9-8-12-15(20-13)21-14(10-18-12)19-11-6-4-3-5-7-11/h3-10H,2H2,1H3,(H3,17,19,20,21,22,23) |
| InChIKey | WPTCPIAHZPNVRN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea?
The IUPAC name of 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea (CID 25151701) is 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea.
What is the SMILES notation for 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea?
The canonical SMILES for 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea is CCNC(=S)Nc1ccc2ncc(Nc3ccccc3)nc2n1.
What is the InChIKey of 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea?
The InChIKey is WPTCPIAHZPNVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6S/c1-2-17-16(23)22-13-9-8-12-15(20-13)21-14(10-18-12)19-11-6-4-3-5-7-11/h3-10H,2H2,1H3,(H3,17,19,20,21,22,23).
What are the key properties of 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea?
1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea has a molecular weight of 324.41 g/mol, XLogP of 3.07, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-anilinopyrido[2,3-b]pyrazin-6-yl)-3-ethylthiourea is sourced from PubChem (CID 25151701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).