About methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate
methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate (PubChem CID 25151859) has the molecular formula C20H22O6
and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate |
| PubChem CID | 25151859 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate |
| SMILES | COC(=O)Cc1c(C(C)=O)c(O)cc(O)c1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C20H22O6/c1-11(2)26-14-7-5-13(6-8-14)20-15(9-18(24)25-4)19(12(3)21)16(22)10-17(20)23/h5-8,10-11,22-23H,9H2,1-4H3 |
| InChIKey | RMBLPLIBBJLCHL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate?
The IUPAC name of methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate (CID 25151859) is methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate.
What is the SMILES notation for methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate?
The canonical SMILES for methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate is COC(=O)Cc1c(C(C)=O)c(O)cc(O)c1-c1ccc(OC(C)C)cc1.
What is the InChIKey of methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate?
The InChIKey is RMBLPLIBBJLCHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O6/c1-11(2)26-14-7-5-13(6-8-14)20-15(9-18(24)25-4)19(12(3)21)16(22)10-17(20)23/h5-8,10-11,22-23H,9H2,1-4H3.
What are the key properties of methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate?
methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate has a molecular weight of 358.39 g/mol, XLogP of 3.47, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-acetyl-3,5-dihydroxy-6-(4-propan-2-yloxyphenyl)phenyl]acetate is sourced from PubChem (CID 25151859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).