About 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one
6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one (PubChem CID 25151963) has the molecular formula C21H19ClF2N2O2
and a molecular weight of 404.84 g/mol. Its IUPAC name is 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
| PubChem CID | 25151963 |
| Molecular Formula | C21H19ClF2N2O2 |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one |
| SMILES | NC1(c2c(F)cccc2F)CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1 |
| InChI | InChI=1S/C21H19ClF2N2O2/c22-15-11-14-12(6-9-26-20(14)27)10-18(15)28-13-4-7-21(25,8-5-13)19-16(23)2-1-3-17(19)24/h1-3,6,9-11,13H,4-5,7-8,25H2,(H,26,27) |
| InChIKey | WZUZLZVCYUNSET-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one?
The IUPAC name of 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one (CID 25151963) is 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one.
What is the SMILES notation for 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one?
The canonical SMILES for 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one is NC1(c2c(F)cccc2F)CCC(Oc2cc3cc[nH]c(=O)c3cc2Cl)CC1.
What is the InChIKey of 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one?
The InChIKey is WZUZLZVCYUNSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClF2N2O2/c22-15-11-14-12(6-9-26-20(14)27)10-18(15)28-13-4-7-21(25,8-5-13)19-16(23)2-1-3-17(19)24/h1-3,6,9-11,13H,4-5,7-8,25H2,(H,26,27).
What are the key properties of 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one?
6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one has a molecular weight of 404.84 g/mol, XLogP of 4.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-amino-4-(2,6-difluorophenyl)cyclohexyl]oxy-7-chloro-2H-isoquinolin-1-one is sourced from PubChem (CID 25151963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).