C9H11N3OS — CID 25152412
4-amino-1,5,6-trimethylthieno[2,3-d]pyrimidin-2-one (PubChem CID 25152412) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-amino-1,5,6-trimethylthieno[2,3-d]pyrimidin-2-one.
| Compound Name | 4-amino-1,5,6-trimethylthieno[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 25152412 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-amino-1,5,6-trimethylthieno[2,3-d]pyrimidin-2-one |
| SMILES | Cc1sc2c(c(N)nc(=O)n2C)c1C |
| InChI | InChI=1S/C9H11N3OS/c1-4-5(2)14-8-6(4)7(10)11-9(13)12(8)3/h1-3H3,(H2,10,11,13) |
| InChIKey | WVJGVKJHZSVEJT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |