C21H17ClF3N7O3S — CID 25152614
N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[(8-oxo-5,6,7,9-tetrahydropyrimido[4,5-b]azepine-4-carbonyl)amino]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 25152614) has the molecular formula C21H17ClF3N7O3S and a molecular weight of 539.93 g/mol. Its IUPAC name is N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[(8-oxo-5,6,7,9-tetrahydropyrimido[4,5-b]azepine-4-carbonyl)amino]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[(8-oxo-5,6,7,9-tetrahydropyrimido[4,5-b]azepine-4-carbonyl)amino]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 25152614 |
| Molecular Formula | C21H17ClF3N7O3S |
| Molecular Weight | 539.93 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[(8-oxo-5,6,7,9-tetrahydropyrimido[4,5-b]azepine-4-carbonyl)amino]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ncnc2c1CCCC(=O)N2)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(Cl)cn2)s1 |
| InChI | InChI=1S/C21H17ClF3N7O3S/c1-9(30-19(35)16-10-3-2-4-15(33)32-17(10)29-8-28-16)20-27-7-13(36-20)18(34)31-14-5-11(21(23,24)25)12(22)6-26-14/h5-9H,2-4H2,1H3,(H,30,35)(H,26,31,34)(H,28,29,32,33)/t9-/m1/s1 |
| InChIKey | SVVMDHBNPUIBAP-SECBINFHSA-N |
| XLogP | 4.02 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |