C26H25N3O3S — CID 25153362
N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]phenyl]-1-phenylmethanesulfonamide (PubChem CID 25153362) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]phenyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]phenyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 25153362 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]phenyl]-1-phenylmethanesulfonamide |
| SMILES | N#Cc1ccc(C2CCN(C(=O)c3cccc(NS(=O)(=O)Cc4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C26H25N3O3S/c27-18-20-9-11-22(12-10-20)23-13-15-29(16-14-23)26(30)24-7-4-8-25(17-24)28-33(31,32)19-21-5-2-1-3-6-21/h1-12,17,23,28H,13-16,19H2 |
| InChIKey | YFJJDOLJTOPJKH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |