C28H41N7O2 — CID 25153367
2-N-(1-adamantyl)-4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(diethylamino)propyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 25153367) has the molecular formula C28H41N7O2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-N-(1-adamantyl)-4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(diethylamino)propyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(1-adamantyl)-4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(diethylamino)propyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 25153367 |
| Molecular Formula | C28H41N7O2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 2-N-(1-adamantyl)-4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(diethylamino)propyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)CCCNc1nc(NCc2ccc3c(c2)OCO3)nc(NC23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C28H41N7O2/c1-3-35(4-2)9-5-8-29-25-31-26(30-17-19-6-7-23-24(13-19)37-18-36-23)33-27(32-25)34-28-14-20-10-21(15-28)12-22(11-20)16-28/h6-7,13,20-22H,3-5,8-12,14-18H2,1-2H3,(H3,29,30,31,32,33,34) |
| InChIKey | PCTMBPBTZVLLSN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|