C21H26ClN5O3 — CID 25154149
(1S,2S,5R)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[(2R)-2-hydroxy-3,3-dimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 25154149) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is (1S,2S,5R)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[(2R)-2-hydroxy-3,3-dimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1S,2S,5R)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[(2R)-2-hydroxy-3,3-dimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 25154149 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (1S,2S,5R)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[(2R)-2-hydroxy-3,3-dimethylbutanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)[C@@H](O)C(=O)N1C[C@@H]2C[C@@H]2[C@H]1C(=O)NCc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C21H26ClN5O3/c1-21(2,3)18(28)20(30)26-9-13-7-15(13)17(26)19(29)24-8-12-6-14(22)4-5-16(12)27-11-23-10-25-27/h4-6,10-11,13,15,17-18,28H,7-9H2,1-3H3,(H,24,29)/t13-,15-,17-,18-/m0/s1 |
| InChIKey | RDEVGCBGXOTPHJ-IKICRFKJSA-N |
| XLogP | 1.79 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |