C34H34ClN3O6 — CID 25154434
6-nitrooxyhexyl 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-(quinolin-2-ylmethoxy)indol-3-yl]acetate (PubChem CID 25154434) has the molecular formula C34H34ClN3O6 and a molecular weight of 616.11 g/mol. Its IUPAC name is 6-nitrooxyhexyl 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-(quinolin-2-ylmethoxy)indol-3-yl]acetate.
| Compound Name | 6-nitrooxyhexyl 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-(quinolin-2-ylmethoxy)indol-3-yl]acetate |
|---|---|
| PubChem CID | 25154434 |
| Molecular Formula | C34H34ClN3O6 |
| Molecular Weight | 616.11 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 6-nitrooxyhexyl 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-(quinolin-2-ylmethoxy)indol-3-yl]acetate |
| SMILES | Cc1c(CC(=O)OCCCCCCO[N+](=O)[O-])c2cc(OCc3ccc4ccccc4n3)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H34ClN3O6/c1-24-30(21-34(39)42-18-6-2-3-7-19-44-38(40)41)31-20-29(43-23-28-15-12-26-8-4-5-9-32(26)36-28)16-17-33(31)37(24)22-25-10-13-27(35)14-11-25/h4-5,8-17,20H,2-3,6-7,18-19,21-23H2,1H3 |
| InChIKey | OOGMXQOLQYOZRC-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.11 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|