About [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid
[(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid (PubChem CID 25155026) has the molecular formula C13H24N2O6
and a molecular weight of 304.34 g/mol. Its IUPAC name is [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid.
Molecular Properties
| Compound Name | [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid |
| PubChem CID | 25155026 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid |
| SMILES | CC1CN(C(=O)OCC[C@H](C)N(C)C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H22N2O2.C2H2O4/c1-9-7-13(8-9)11(14)15-6-5-10(2)12(3)4;3-1(4)2(5)6/h9-10H,5-8H2,1-4H3;(H,3,4)(H,5,6)/t10-;/m0./s1 |
| InChIKey | NXVLXTFDBDRYLD-PPHPATTJSA-N |
| XLogP | 0.57 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid?
The IUPAC name of [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid (CID 25155026) is [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid.
What is the SMILES notation for [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid?
The canonical SMILES for [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid is CC1CN(C(=O)OCC[C@H](C)N(C)C)C1.O=C(O)C(=O)O.
What is the InChIKey of [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid?
The InChIKey is NXVLXTFDBDRYLD-PPHPATTJSA-N. The full InChI is InChI=1S/C11H22N2O2.C2H2O4/c1-9-7-13(8-9)11(14)15-6-5-10(2)12(3)4;3-1(4)2(5)6/h9-10H,5-8H2,1-4H3;(H,3,4)(H,5,6)/t10-;/m0./s1.
What are the key properties of [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid?
[(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid has a molecular weight of 304.34 g/mol, XLogP of 0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-(dimethylamino)butyl] 3-methylazetidine-1-carboxylate;oxalic acid is sourced from PubChem (CID 25155026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).