C54H60O12 — CID 25155053
3-[1-[4-[3,5-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]phenoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 25155053) has the molecular formula C54H60O12 and a molecular weight of 901.06 g/mol. Its IUPAC name is 3-[1-[4-[3,5-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]phenoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-[1-[4-[3,5-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]phenoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 25155053 |
| Molecular Formula | C54H60O12 |
| Molecular Weight | 901.06 g/mol |
| Exact Mass | 900.41 |
| IUPAC Name | 3-[1-[4-[3,5-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]phenoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | C=C(c1ccc(Oc2cc(Oc3ccc(C(=C)C4COC5(CCCCC5)OO4)cc3)cc(Oc3ccc(C(=C)C4COC5(CCCCC5)OO4)cc3)c2)cc1)C1COC2(CCCCC2)OO1 |
| InChI | InChI=1S/C54H60O12/c1-37(49-34-55-52(64-61-49)25-7-4-8-26-52)40-13-19-43(20-14-40)58-46-31-47(59-44-21-15-41(16-22-44)38(2)50-35-56-53(65-62-50)27-9-5-10-28-53)33-48(32-46)60-45-23-17-42(18-24-45)39(3)51-36-57-54(66-63-51)29-11-6-12-30-54/h13-24,31-33,49-51H,1-12,25-30,34-36H2 |
| InChIKey | PRFCTVHQZMWKLO-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.06 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|