About 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate
1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate (PubChem CID 25155293) has the molecular formula C12H21NO5
and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate |
| PubChem CID | 25155293 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate |
| SMILES | CC(OC(=O)CCC(=O)CN)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H21NO5/c1-8(18-11(16)12(2,3)4)17-10(15)6-5-9(14)7-13/h8H,5-7,13H2,1-4H3 |
| InChIKey | VJDXOZDVKPMAAS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate?
The IUPAC name of 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate (CID 25155293) is 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate.
What is the SMILES notation for 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate?
The canonical SMILES for 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate is CC(OC(=O)CCC(=O)CN)OC(=O)C(C)(C)C.
What is the InChIKey of 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate?
The InChIKey is VJDXOZDVKPMAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO5/c1-8(18-11(16)12(2,3)4)17-10(15)6-5-9(14)7-13/h8H,5-7,13H2,1-4H3.
What are the key properties of 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate?
1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate has a molecular weight of 259.30 g/mol, XLogP of 0.77, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropanoyloxy)ethyl 5-amino-4-oxopentanoate is sourced from PubChem (CID 25155293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).