About N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide
N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide (PubChem CID 25155343) has the molecular formula C23H17Cl2N3O3
and a molecular weight of 454.31 g/mol. Its IUPAC name is N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide.
Molecular Properties
| Compound Name | N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide |
| PubChem CID | 25155343 |
| Molecular Formula | C23H17Cl2N3O3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc2ncn(Cc3ccc(Cl)c(Cl)c3)c(=O)c2c1 |
| InChI | InChI=1S/C23H17Cl2N3O3/c24-19-8-6-15(10-20(19)25)12-28-14-26-21-9-7-16(11-18(21)23(28)30)27-22(29)13-31-17-4-2-1-3-5-17/h1-11,14H,12-13H2,(H,27,29) |
| InChIKey | KOAUQKJNSJNVIB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide?
The IUPAC name of N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide (CID 25155343) is N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide.
What is the SMILES notation for N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide?
The canonical SMILES for N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide is O=C(COc1ccccc1)Nc1ccc2ncn(Cc3ccc(Cl)c(Cl)c3)c(=O)c2c1.
What is the InChIKey of N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide?
The InChIKey is KOAUQKJNSJNVIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17Cl2N3O3/c24-19-8-6-15(10-20(19)25)12-28-14-26-21-9-7-16(11-18(21)23(28)30)27-22(29)13-31-17-4-2-1-3-5-17/h1-11,14H,12-13H2,(H,27,29).
What are the key properties of N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide?
N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide has a molecular weight of 454.31 g/mol, XLogP of 4.77, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3,4-dichlorophenyl)methyl]-4-oxoquinazolin-6-yl]-2-phenoxyacetamide is sourced from PubChem (CID 25155343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).