About pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate
pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 25155420) has the molecular formula C25H22N4O3S
and a molecular weight of 458.54 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate |
| PubChem CID | 25155420 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Nc1ccc(-c2ccsc2)cc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C25H22N4O3S/c26-22-8-7-20(21-9-11-33-16-21)12-23(22)29-24(30)19-5-3-17(4-6-19)14-28-25(31)32-15-18-2-1-10-27-13-18/h1-13,16H,14-15,26H2,(H,28,31)(H,29,30) |
| InChIKey | ZDLODVWVKREMMG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate?
The IUPAC name of pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate (CID 25155420) is pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate.
What is the SMILES notation for pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate?
The canonical SMILES for pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate is Nc1ccc(-c2ccsc2)cc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1.
What is the InChIKey of pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate?
The InChIKey is ZDLODVWVKREMMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N4O3S/c26-22-8-7-20(21-9-11-33-16-21)12-23(22)29-24(30)19-5-3-17(4-6-19)14-28-25(31)32-15-18-2-1-10-27-13-18/h1-13,16H,14-15,26H2,(H,28,31)(H,29,30).
What are the key properties of pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate?
pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate has a molecular weight of 458.54 g/mol, XLogP of 5.07, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]methyl]carbamate is sourced from PubChem (CID 25155420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).