About pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate
pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 25155421) has the molecular formula C27H23N3O4
and a molecular weight of 453.50 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate |
| PubChem CID | 25155421 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2O)cc1)OCc1cccnc1 |
| InChI | InChI=1S/C27H23N3O4/c31-25-13-12-23(21-6-2-1-3-7-21)15-24(25)30-26(32)22-10-8-19(9-11-22)17-29-27(33)34-18-20-5-4-14-28-16-20/h1-16,31H,17-18H2,(H,29,33)(H,30,32) |
| InChIKey | ARFGMMYMOKJURJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate?
The IUPAC name of pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate (CID 25155421) is pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate.
What is the SMILES notation for pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate?
The canonical SMILES for pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate is O=C(NCc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2O)cc1)OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate?
The InChIKey is ARFGMMYMOKJURJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23N3O4/c31-25-13-12-23(21-6-2-1-3-7-21)15-24(25)30-26(32)22-10-8-19(9-11-22)17-29-27(33)34-18-20-5-4-14-28-16-20/h1-16,31H,17-18H2,(H,29,33)(H,30,32).
What are the key properties of pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate?
pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate has a molecular weight of 453.50 g/mol, XLogP of 5.13, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl N-[[4-[(2-hydroxy-5-phenylphenyl)carbamoyl]phenyl]methyl]carbamate is sourced from PubChem (CID 25155421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).