C28H38O5 — CID 25155440
(2R,3aR,5'S,9R,9aR)-6,8-dihydroxy-5',9a-dimethyl-9-(2-methylpropyl)-1'-propan-2-ylspiro[1,3,3a,9-tetrahydrocyclopenta[b]chromene-2,6'-cyclohexene]-5,7-dicarbaldehyde (PubChem CID 25155440) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is (2R,3aR,5'S,9R,9aR)-6,8-dihydroxy-5',9a-dimethyl-9-(2-methylpropyl)-1'-propan-2-ylspiro[1,3,3a,9-tetrahydrocyclopenta[b]chromene-2,6'-cyclohexene]-5,7-dicarbaldehyde.
| Compound Name | (2R,3aR,5'S,9R,9aR)-6,8-dihydroxy-5',9a-dimethyl-9-(2-methylpropyl)-1'-propan-2-ylspiro[1,3,3a,9-tetrahydrocyclopenta[b]chromene-2,6'-cyclohexene]-5,7-dicarbaldehyde |
|---|---|
| PubChem CID | 25155440 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (2R,3aR,5'S,9R,9aR)-6,8-dihydroxy-5',9a-dimethyl-9-(2-methylpropyl)-1'-propan-2-ylspiro[1,3,3a,9-tetrahydrocyclopenta[b]chromene-2,6'-cyclohexene]-5,7-dicarbaldehyde |
| SMILES | CC(C)C[C@H]1c2c(O)c(C=O)c(O)c(C=O)c2O[C@@H]2C[C@@]3(C[C@@]21C)C(C(C)C)=CCC[C@@H]3C |
| InChI | InChI=1S/C28H38O5/c1-15(2)10-21-23-25(32)18(12-29)24(31)19(13-30)26(23)33-22-11-28(14-27(21,22)6)17(5)8-7-9-20(28)16(3)4/h9,12-13,15-17,21-22,31-32H,7-8,10-11,14H2,1-6H3/t17-,21-,22+,27+,28-/m0/s1 |
| InChIKey | DSUVATLIAOWHNE-VTYAYYBQSA-N |
| XLogP | 6.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|