C21H31FN8O — CID 25155478
[3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone (PubChem CID 25155478) has the molecular formula C21H31FN8O and a molecular weight of 430.53 g/mol. Its IUPAC name is [3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone.
| Compound Name | [3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 25155478 |
| Molecular Formula | C21H31FN8O |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | [3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone |
| SMILES | Cc1ncc(F)c(Nc2n[nH]c3c2CN(C(=O)N2CC(C)(C)N(C)C[C@@H]2C)C3(C)C)n1 |
| InChI | InChI=1S/C21H31FN8O/c1-12-9-28(7)20(3,4)11-29(12)19(31)30-10-14-16(21(30,5)6)26-27-17(14)25-18-15(22)8-23-13(2)24-18/h8,12H,9-11H2,1-7H3,(H2,23,24,25,26,27)/t12-/m0/s1 |
| InChIKey | KHVXVEAQTZXJAO-LBPRGKRZSA-N |
| XLogP | 2.98 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |