C14H12ClF4N5O — CID 25155624
(2S)-2-[[2-(2-chloro-3-pyridinyl)-5-fluoropyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 25155624) has the molecular formula C14H12ClF4N5O and a molecular weight of 377.73 g/mol. Its IUPAC name is (2S)-2-[[2-(2-chloro-3-pyridinyl)-5-fluoropyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | (2S)-2-[[2-(2-chloro-3-pyridinyl)-5-fluoropyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 25155624 |
| Molecular Formula | C14H12ClF4N5O |
| Molecular Weight | 377.73 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (2S)-2-[[2-(2-chloro-3-pyridinyl)-5-fluoropyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | C[C@H](Nc1nc(-c2cccnc2Cl)ncc1F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H12ClF4N5O/c1-7(13(25)22-6-14(17,18)19)23-12-9(16)5-21-11(24-12)8-3-2-4-20-10(8)15/h2-5,7H,6H2,1H3,(H,22,25)(H,21,23,24)/t7-/m0/s1 |
| InChIKey | NKYYTNUSSVXXKK-ZETCQYMHSA-N |
| XLogP | 2.81 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.73 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|