C26H28FNO6 — CID 25155726
dipropan-2-yl (3S,5R)-1-benzyl-4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylate (PubChem CID 25155726) has the molecular formula C26H28FNO6 and a molecular weight of 469.51 g/mol. Its IUPAC name is dipropan-2-yl (3S,5R)-1-benzyl-4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylate.
| Compound Name | dipropan-2-yl (3S,5R)-1-benzyl-4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 25155726 |
| Molecular Formula | C26H28FNO6 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | dipropan-2-yl (3S,5R)-1-benzyl-4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1C(=O)N(Cc2ccccc2)C(=O)[C@H](C(=O)OC(C)C)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FNO6/c1-15(2)33-25(31)21-20(18-10-12-19(27)13-11-18)22(26(32)34-16(3)4)24(30)28(23(21)29)14-17-8-6-5-7-9-17/h5-13,15-16,20-22H,14H2,1-4H3/t20?,21-,22+ |
| InChIKey | JVRQTMGHVSUMBB-FRIKZZABSA-N |
| XLogP | 3.61 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|