C22H33FN8O — CID 25155748
[3-[(2-ethyl-5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone (PubChem CID 25155748) has the molecular formula C22H33FN8O and a molecular weight of 444.56 g/mol. Its IUPAC name is [3-[(2-ethyl-5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone.
| Compound Name | [3-[(2-ethyl-5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 25155748 |
| Molecular Formula | C22H33FN8O |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | [3-[(2-ethyl-5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone |
| SMILES | CCc1ncc(F)c(Nc2n[nH]c3c2CN(C(=O)N2CC(C)(C)N(C)C[C@@H]2C)C3(C)C)n1 |
| InChI | InChI=1S/C22H33FN8O/c1-8-16-24-9-15(23)19(25-16)26-18-14-11-31(22(5,6)17(14)27-28-18)20(32)30-12-21(3,4)29(7)10-13(30)2/h9,13H,8,10-12H2,1-7H3,(H2,24,25,26,27,28)/t13-/m0/s1 |
| InChIKey | CUIKRBMBZGRFEG-ZDUSSCGKSA-N |
| XLogP | 3.23 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |