C22H35N9O — CID 25156024
[3-[[2-(ethylamino)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone (PubChem CID 25156024) has the molecular formula C22H35N9O and a molecular weight of 441.58 g/mol. Its IUPAC name is [3-[[2-(ethylamino)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone.
| Compound Name | [3-[[2-(ethylamino)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 25156024 |
| Molecular Formula | C22H35N9O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | [3-[[2-(ethylamino)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S)-2,4,5,5-tetramethylpiperazin-1-yl]methanone |
| SMILES | CCNc1nccc(Nc2n[nH]c3c2CN(C(=O)N2CC(C)(C)N(C)C[C@@H]2C)C3(C)C)n1 |
| InChI | InChI=1S/C22H35N9O/c1-8-23-19-24-10-9-16(26-19)25-18-15-12-31(22(5,6)17(15)27-28-18)20(32)30-13-21(3,4)29(7)11-14(30)2/h9-10,14H,8,11-13H2,1-7H3,(H3,23,24,25,26,27,28)/t14-/m0/s1 |
| InChIKey | ULEAFQYUMKDDJU-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |