C20H28O3 — CID 25156380
(2S,4aS,4bR,7R,8aR)-2-ethenyl-7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,7,8a,9-hexahydro-1H-phenanthrene-3,6-dione (PubChem CID 25156380) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2S,4aS,4bR,7R,8aR)-2-ethenyl-7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,7,8a,9-hexahydro-1H-phenanthrene-3,6-dione.
| Compound Name | (2S,4aS,4bR,7R,8aR)-2-ethenyl-7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,7,8a,9-hexahydro-1H-phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 25156380 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (2S,4aS,4bR,7R,8aR)-2-ethenyl-7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,7,8a,9-hexahydro-1H-phenanthrene-3,6-dione |
| SMILES | C=C[C@]1(C)CC2=CC[C@H]3C(C)(C)[C@@H](O)C(=O)C[C@]3(C)[C@H]2CC1=O |
| InChI | InChI=1S/C20H28O3/c1-6-19(4)10-12-7-8-15-18(2,3)17(23)14(21)11-20(15,5)13(12)9-16(19)22/h6-7,13,15,17,23H,1,8-11H2,2-5H3/t13-,15-,17-,19+,20+/m0/s1 |
| InChIKey | ZTJAMBHQVLABGR-HKIZTLLZSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|