C16H13Cl3N2O3 — CID 2515658
[2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 2515658) has the molecular formula C16H13Cl3N2O3 and a molecular weight of 387.65 g/mol. Its IUPAC name is [2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2515658 |
| Molecular Formula | C16H13Cl3N2O3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | [2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cccnc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O3/c1-9(11-5-4-10(17)7-13(11)18)21-14(22)8-24-16(23)12-3-2-6-20-15(12)19/h2-7,9H,8H2,1H3,(H,21,22)/t9-/m1/s1 |
| InChIKey | YNCZVEZOSUWNSK-SECBINFHSA-N |
| XLogP | 4.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|