C20H28O3 — CID 25156697
(3aS,6E,10Z,14E,15aS)-10-(hydroxymethyl)-6,14-dimethyl-3-methylidene-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one (PubChem CID 25156697) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3aS,6E,10Z,14E,15aS)-10-(hydroxymethyl)-6,14-dimethyl-3-methylidene-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one.
| Compound Name | (3aS,6E,10Z,14E,15aS)-10-(hydroxymethyl)-6,14-dimethyl-3-methylidene-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one |
|---|---|
| PubChem CID | 25156697 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3aS,6E,10Z,14E,15aS)-10-(hydroxymethyl)-6,14-dimethyl-3-methylidene-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@H]2/C=C(\C)CC/C=C(\CO)CC/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C20H28O3/c1-14-6-4-8-17(13-21)9-5-7-15(2)12-19-18(11-10-14)16(3)20(22)23-19/h6,9,12,18-19,21H,3-5,7-8,10-11,13H2,1-2H3/b14-6+,15-12+,17-9-/t18-,19-/m0/s1 |
| InChIKey | ZMVCRUREHOFWFQ-QXRWMXRCSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|