C20H32O4 — CID 25156700
(1S,2E,6E,9E,11R,14S)-11-hydroperoxy-14-(3-hydroxyprop-1-en-2-yl)-3,7,11-trimethylcyclotetradeca-2,6,9-trien-1-ol (PubChem CID 25156700) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1S,2E,6E,9E,11R,14S)-11-hydroperoxy-14-(3-hydroxyprop-1-en-2-yl)-3,7,11-trimethylcyclotetradeca-2,6,9-trien-1-ol.
| Compound Name | (1S,2E,6E,9E,11R,14S)-11-hydroperoxy-14-(3-hydroxyprop-1-en-2-yl)-3,7,11-trimethylcyclotetradeca-2,6,9-trien-1-ol |
|---|---|
| PubChem CID | 25156700 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1S,2E,6E,9E,11R,14S)-11-hydroperoxy-14-(3-hydroxyprop-1-en-2-yl)-3,7,11-trimethylcyclotetradeca-2,6,9-trien-1-ol |
| SMILES | C=C(CO)[C@@H]1CC[C@@](C)(OO)/C=C/C/C(C)=C/CC/C(C)=C/[C@@H]1O |
| InChI | InChI=1S/C20H32O4/c1-15-7-5-8-16(2)13-19(22)18(17(3)14-21)10-12-20(4,24-23)11-6-9-15/h6-7,11,13,18-19,21-23H,3,5,8-10,12,14H2,1-2,4H3/b11-6+,15-7+,16-13+/t18-,19-,20-/m0/s1 |
| InChIKey | HGPWGHBBMMTDTA-WWWHTDTNSA-N |
| XLogP | 4.17 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|